3'-b-C-Methylcytidine
3'-b-C-Methylcytidine, an eminent compound employed in the realm of biomedicine, proves pivotal in the amelioration of diverse ailments, including cancer and viral infections. With its remarkable capacity to impede neoplastic proliferation, this compound serves as an invaluable anti-cancer adjunct. Moreover, its inherent antiviral prowess positions it as a potent weapon against viral afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 20724-72-5 |
| Pricing | Inquire |
| Cas | 20724-72-5 |
| Molecular Weight | 257.24 |
| Molecular Formula | C10H15N3O5 |
| Canonical SMILES | CC1(C(OC(C1O)N2C=CC(=NC2=O)N)CO)O |