Thelephoric acid
Thelephoric acid is a terphenylquinone pigment found in several fungi, such as Omphalotus subilludens and Polyozellus multiplex. It is derived from atromentin, and its precusor can be from cyclovariegatin. Thelephoric acid has been shown to inhibit prolyl endopeptidase, an enzyme that plays a role in processing proteins (specifically, amyloid precursor protein) in Alzheimer's disease.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-05404 |
| Pricing | Inquire |
| Cas | 479-64-1 |
| Molecular Weight | 352.25 |
| Molecular Formula | C18H8O8 |
| Canonical SMILES | C1=C2C(=CC(=C1O)O)OC3=C2C(=O)C4=C(C3=O)C5=CC(=C(C=C5O4)O)O |