6-Deoxy-2,3:4,5-di-O-isopropylidene-L-glucose
6-Deoxy-2,3:4,5-di-O-isopropylidene-L-glucose, an intriguing compound enveloped in the depths of the biomedical industry, unveils itself as a potential panacea to combat a myriad of ailments, notably diabetes mellitus and cancer. Its arcane molecular configuration beckons researchers to embark on a quest for novel therapeutic interventions. The delicately interconnected atoms within this compound whisper promises of groundbreaking advancements in drug development.
| Supplier | BOC Sciences |
|---|---|
| Product # | 116096-54-9 |
| Pricing | Inquire |
| Cas | 116096-54-9 |
| Molecular Weight | 244.29 |
| Molecular Formula | C12H20O5 |
| Canonical SMILES | CC1C(OC(O1)(C)C)C2C(OC(O2)(C)C)C=O |