Phenyl b-D-glucuronide
Phenyl b-D-glucuronide, a biochemical compound, serves as a metabolite of phenylalanine. Researchers widely utilize it in clinical studies to explore the complex phenylalanine metabolic pathway and its potential involvement in phenylketonuria development. Additionally, it is a valuable marker for assessing liver function and detecting liver diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 17685-05-1 |
| Pricing | Inquire |
| Cas | 17685-05-1 |
| Molecular Weight | 270.24 |
| Molecular Formula | C12H14O7 |
| Canonical SMILES | C1=CC=C(C=C1)OC2C(C(C(C(O2)C(=O)O)O)O)O |