2'-O-Methyl-2-thiouridine
2'-O-Methyl-2-thiouridine is a valuable compound widely used in biomedicine. It acts as an RNA modification tool, incorporating into RNA molecules during synthesis. This powerful molecule exhibits antiviral activity against various viral infections, making it a potential therapeutic option for treating RNA virus-associated diseases. Its unique properties and versatility make it an essential tool for studying RNA biology and developing antiviral therapies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 113886-72-9 |
| Pricing | Inquire |
| Cas | 113886-72-9 |
| Molecular Weight | 274.29 |
| Molecular Formula | C10H14N2O5S |
| Canonical SMILES | COC1C(C(OC1N2C=CC(=O)NC2=S)CO)O |