5'-O-(4,4'-Dimethoxytrityl)-2'-O-methyl-2-thiouridine
5'-O-(4,4'-Dimethoxytrityl)-2'-O-methyl-2-thiouridine is a valuable compound widely used in the biomedical industry. It plays a crucial role in the synthesis of modified nucleosides, serving as a key building block in the development of antiviral and anticancer drugs. Additionally, it aids in the study and understanding of various diseases related to nucleotide metabolism and viral replication processes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 302918-83-8 |
| Pricing | Inquire |
| Cas | 302918-83-8 |
| Molecular Weight | 576.66 |
| Molecular Formula | C31H32N2O7S |
| Canonical SMILES | COC1C(C(OC1N2C=CC(=O)NC2=S)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)O |