7'-O-(4,4'-Dimethoxytrityloxy)morpholinothymine
7'-O-(4,4'-Dimethoxytrityloxy)morpholinothymine is a crucial compound in biomedicine extensively used in the pharmaceutical industry. It exhibits potential as an antiviral drug against herpesviruses and is researched for its promising role in the treatment of various viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 143485-05-6 |
| Pricing | Inquire |
| Cas | 143485-05-6 |
| Molecular Weight | 543.61 |
| Molecular Formula | C31H33N3O6 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CNCC(O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC |