1-methyl-tryptophan
1-methyl-tryptophan is an indoleamine 2,3-dioxygenase (IDO) inhibitor. Co-treatment with IFN-γ and 1-methyl-tryptophan markedly reduces the activity of human cardiac myofibroblasts (hCMs) expressing α-SMA and induces apoptosis through up-regulating the IRF-1, Fas, and FasL genes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 26988-72-7 |
| Pricing | Inquire |
| Cas | 26988-72-7 |
| Molecular Weight | 218.25 |
| Molecular Formula | C12H14N2O2 |
| Canonical SMILES | CN1C=C(C2=CC=CC=C21)CC(C(=O)O)N |