Leucinostatin B
It is produced by the strain of Paecilomyces lilacinus A-267. It's a peptide antibiotic. It has a strong anti-pathogenic and non-pathogenic yeast and fungi activity, but also has a medium anti-bacterial effect. It was previously reported that Leucinostatin A and B mixtures inhibited HeLa cells. 0.05 μg/mL of Leucinostatin B for a week (0.25 mg/kg・d) has inhibitory effect on the airy ascites carcinoma entity type, and for ascites type is invalid.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02252 |
| Pricing | Inquire |
| Cas | 76663-52-0 |
| Molecular Weight | 1204.58 |
| Molecular Formula | C61H109N11O13 |
| Canonical SMILES | CCC(C)C=CC(=O)N1CC(CC1C(=O)NC(CC(C)CC(CC(=O)CC)O)C(=O)NC(C(C(C)C)O)C(=O)NC(C)(C)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)NCCC(=O)NC(C)CNC)C |