Nrf2 activator-1
Nrf2 activator-1, a potent NF-E2 related factor 2 (Nrf2) activator, has the potential to treat COPD and other respiratory diseases, including asthma, acute lung injury (ALI), acute respiratory distress syndrome (ARDS) and pulmonary fibrosis. (Extracted from patent WO2018109647A1)
| Supplier | BOC Sciences |
|---|---|
| Product # | 2230697-41-1 |
| Pricing | Inquire |
| Cas | 2230697-41-1 |
| Molecular Weight | 578.68 |
| Molecular Formula | C30H34N4O6S |
| Canonical SMILES | CCOC(=O)CC(C1=CC(=C(C=C1)C)CN2CC(OC3=CC=CC=C3S2(=O)=O)C)C4=CC5=C(C(=C4)OC)N(N=N5)C |