C18:2 anandamide phosphate Sodium salt
C18:2 anandamide phosphate Sodium salt, a derivative of anandamide, a prominent endocannabinoid compound, is widely utilized in scientific investigations due to its potential involvement in diverse physiological processes. Research findings indicate promising therapeutic prospects for pain modulation, inflammation control, and neurological ailment management.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2260670-52-6 |
| Pricing | Inquire |
| Cas | 2260670-52-6 |
| Molecular Weight | 425.48 |
| Molecular Formula | C20H37NO5PNa |
| Canonical SMILES | CCCCCC=CCC=CCCCCCCCC(=O)NCCOP(=O)(O)[O-].[Na+] |