PB-5266 C
PB-5266 C is a monobactam antibiotic isolated from the culture filtrate of Cytophaga johnsonae PB-5266. It exhibited weak antibacterial activity against a sensitive mutant of Escherichia coli to beta-lactam antibiotics.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-03332 |
| Pricing | Inquire |
| Cas | 108065-96-9 |
| Molecular Weight | 423.36 |
| Molecular Formula | C12H17N5O10S |
| Canonical SMILES | C1C(C(=O)N1S(=O)(=O)O)NC(=O)C(=CC(=O)N)NC(=O)CNC(=O)C(CO)O |