5-(Trifluoromethyl)dibenzothiophenium tetrafluoroborate
5-(Trifluoromethyl)dibenzothiophenium tetrafluoroborate (CAS# 131880-16-5) is used to synthesize ortho-trifluoromethylated and ortho-(fluoro)alkylated pyridine derivatives. It is used as a CF3 source under visible light irradiation for the photoredox-catalyzed trifluoromethylation of electron rich alkene resulting in 1,3-bis(trifluoromethyl)-1-propenyl skeleton.
| Supplier | BOC Sciences |
|---|---|
| Product # | 131880-16-5 |
| Pricing | Inquire |
| Cas | 131880-16-5 |
| Molecular Weight | 340.07 |
| Molecular Formula | C13H8BF7S |
| Canonical SMILES | [B-](F)(F)(F)F.C1=CC=C2C(=C1)C3=CC=CC=C3[S+]2C(F)(F)F |