2-Chloro-6-(β-D-2-deoxyribofuranosyl)-3,5-diaminopyrazine
2-Chloro-6-(β-D-2-deoxyribofuranosyl)-3,5-diaminopyrazine is an antiviral compound, engaging in fierce confrontations with malevolent DNA and RNA viruses, then skillfully nullifying their harmful influence. By virtue of its extraordinary mechanism, it diligently curtails viral replication, thus diminishing viral burdens and alleviating the plaguing distress associated with viral afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 173256-61-6 |
| Pricing | Inquire |
| Cas | 173256-61-6 |
| Molecular Weight | 260.68 |
| Molecular Formula | C9H13ClN4O3 |
| Canonical SMILES | C1C(C(OC1C2=C(N=C(C(=N2)Cl)N)N)CO)O |