Progesterone 6-Oxo Impurity
An impurity of Progesterone. Progesterone is an endogenous steroid and progestogen sex hormone involved in the menstrual cycle, pregnancy, and embryogenesis of humans and other species. Progesterone is also a crucial metabolic intermediate in the production of other endogenous steroids, including the sex hormones and the corticosteroids, and plays an important role in brain function as a neurosteroid.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2694-175130 |
| Pricing | Inquire |
| Cas | 2243-08-5 |
| Molecular Weight | 328.46 |
| Molecular Formula | C21H28O3 |
| Canonical SMILES | CC(=O)C1CCC2C1(CCC3C2CC(=O)C4=CC(=O)CCC34C)C |