Lamivudine 5'-monophosphate ammonium salt
Lamivudine 5'-monophosphate ammonium salt astutely presents itself as a paramount pharmaceutical compound, which aptly grapples with the dire repercussions of viral infections. Functioning as a formidable nucleotide analog reverse transcriptase inhibitor, its unwavering focus lies in the meticulous targeting of both HIV-1 and hepatitis B virus infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1187058-40-7 |
| Pricing | Inquire |
| Cas | 1187058-40-7 |
| Molecular Weight | 326.27 |
| Molecular Formula | C8H15N4O6PS |
| Canonical SMILES | C1C(OC(S1)COP(=O)(O)[O-])N2C=CC(=NC2=O)N.[NH4+] |