1,2,4,6-Tetra-O-acetyl-b-D-glucopyranose
1,2,4,6-Tetra-O-acetyl-beta-D-glucopyranose, a chemical compound utilized for the synthesis of glycoconjugates and complex carbohydrates, emerges as a critically important entity. In its role as a glucose protectant, it selectively enhances the addition of specialized functional groups. Its exceptional potentiality in developing drugs, particularly for cancer and inflammatory diseases, highlights the compound's indispensability.
| Supplier | BOC Sciences |
|---|---|
| Product # | 27086-14-2 |
| Pricing | Inquire |
| Cas | 27086-14-2 |
| Molecular Weight | 348.30 |
| Molecular Formula | C14H20O10 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OC(=O)C)OC(=O)C)O)OC(=O)C |