2-Azidoethyl 2-acetamido-2-deoxy-b-D-glucopyranoside
2-Azidoethyl 2-acetamido-2-deoxy-b-D-glucopyranoside is a versatile compound widely used in the biomedical industry. It serves as a valuable tool in drug discovery and development, specifically for synthesizing new carbohydrate-based antibiotics and antiviral drugs. Additionally, this compound is employed in research related to glycobiology and molecular biology, aiding in the study of glycoproteins and glycolipids involved in various diseases, including cancer and infectious diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 142072-12-6 |
| Pricing | Inquire |
| Cas | 142072-12-6 |
| Molecular Weight | 290.27 |
| Molecular Formula | C10H18N4O6 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OCCN=[N+]=[N-])CO)O)O |