ADP-heptose
ADP-heptose is a molecule composed of adenosine diphosphate (ADP) linked to a heptose sugar molecule. Heptose sugars are commonly found in bacterial lipopolysaccharides (LPS) and are crucial for the structural integrity and immunogenicity of these molecules. ADP-heptose is involved in the biosynthesis of LPS, which is an essential component of the outer membrane of Gram-negative bacteria. LPS plays a critical role in bacterial virulence and host-pathogen interactions. Studying ADP-heptose can provide insights into bacterial physiology, pathogenesis, and potential targets for antibiotic development.
| Supplier | BOC Sciences |
|---|---|
| Product # | BRP-00667 |
| Pricing | Inquire |
| Cas | 322640-28-8 |
| Molecular Weight | 619.37 |
| Molecular Formula | C17H27N5O16P2 |
| Canonical SMILES | C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OC4C(C(C(C(O4)C(CO)O)O)O)O)O)O)N |