SHA 68
SHA 68 is a selective neuropeptide S receptor (NPSR) antagonist (IC50 = 22.0 and 23.8 nM for human NPSR Asn107 and Ile107 variants, respectively) that displays no activity against a range of 14 GPCRs, including vasopressin and oxytocin receptors.
| Supplier | BOC Sciences |
|---|---|
| Product # | 847553-89-3 |
| Pricing | Inquire |
| Cas | 847553-89-3 |
| Molecular Weight | 445.49 |
| Molecular Formula | C26H24FN3O3 |
| Canonical SMILES | C1CN2C(CN1C(=O)NCC3=CC=C(C=C3)F)C(OC2=O)(C4=CC=CC=C4)C5=CC=CC=C5 |