(±)5-HETE lactone
(±) 5-HETE Lactone is a unique marker for 5-lipoxygenase activation. (±) 5-HETE Lactone is a cyclic ester formed by acid-catalyzed nucleophilic addition of the C-5 hydroxyl to the C-1 carboxyl of (±)5-HETE. It inhibits 5-LO (5-lipoxygenase) (IC50=27 µM) from rat basophilic leukemia cells. The lactone form is several times more potent.
| Supplier | BOC Sciences |
|---|---|
| Product # | 73279-37-5 |
| Pricing | Inquire |
| Cas | 73279-37-5 |
| Molecular Weight | 302.5 |
| Molecular Formula | C20H30O2 |
| Canonical SMILES | CCCCCC=CCC=CCC=CC=CC1CCCC(=O)O1 |