1-Iodo-4-methyl-4-[(trimethylsilyl)oxy]-1E-octene
1-Iodo-4-methyl-4-[(trimethylsilyl)oxy]-1E-octene is an intermediate in the synthesis of 8-iso Misoprostol (I821345), a very widely sold analog of prostaglandin E1, which is potent but acts as a non-selective agonist towards the prostanoid EP receptor subgroup.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB063665 |
| Pricing | Inquire |
| Cas | 62555-05-9 |
| Molecular Weight | 340.32 |
| Molecular Formula | C12H25IOSi |
| Canonical SMILES | CCCCC(C)(CC=CI)O[Si](C)(C)C |