3-Indoxyl Sulfate-[d5] potassium salt
3-Indoxyl Sulfate-[d5] potassium salt is the labelled analogue of 3-Indoxyl Sulfate potassium salt. 3-Indoxyl Sulfate potassium salt is a uremic toxin that acts as a potent endogenous agonist for the human aryl hydrocarbon receptor (AHR).
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-013755 |
| Pricing | Inquire |
| Cas | 1644451-34-2 |
| Molecular Weight | 256.33 |
| Molecular Formula | C8HD5KNO4S |
| Canonical SMILES | C1=CC=C2C(=C1)C(=CN2)OS(=O)(=O)[O-].[K+] |