5'-Hydrazino-5'-deoxyguanosine
5'-Hydrazino-5'-deoxyguanosine is a valuable biomolecule acting as a key reagent in DNA and RNA research for specialized investigations. It has shown significant potential in the research and development of anti-viral and anti-cancer therapies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1189743-60-9 |
| Pricing | Inquire |
| Cas | 1189743-60-9 |
| Molecular Weight | 297.27 |
| Molecular Formula | C10H15N7O4 |
| Canonical SMILES | C1=NC2=C(N1C3C(C(C(O3)CNN)O)O)N=C(NC2=O)N |