5-[N-(2-Aminoethyl)-3-(E)-acrylamido]-5'-O-(dimethoxytrityl)-2'-deoxyuridine
5-[N-(2-Aminoethyl)-3-(E)-acrylamido]-5'-O-(dimethoxytrityl)-2'-deoxyuridine is an indispensable compound serving as a foundational unit for the fabrication of altered oligonucleotides. These synthetic genetic constructs spearhead unparalleled developments in realms such as gene therapy and nucleic acid-oriented diagnostics.
| Supplier | BOC Sciences |
|---|---|
| Product # | 606126-32-3 |
| Pricing | Inquire |
| Cas | 606126-32-3 |
| Molecular Weight | 642.72 |
| Molecular Formula | C35H38N4O8 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4C(CC(O4)N5C=C(C(=O)NC5=O)C=CC(=O)NCCN)O |