1,4-b-D-Cellotriitol
1,4-b-D-Cellotriitol is a natural compound acting as an inhibitor to various glycosidases and glucosidase enzymes. This property opens doors to study its potential effects on diseases associated with enzyme dysfunctions, like Gaucher's disease.
| Supplier | BOC Sciences |
|---|---|
| Product # | 61473-64-1 |
| Pricing | Inquire |
| Cas | 61473-64-1 |
| Molecular Weight | 506.45 |
| Molecular Formula | C18H34O16 |
| Canonical SMILES | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC(C(CO)O)C(C(CO)O)O)CO)O)O)O)O |