3-Chloro-4-(methylsulfonyl)benzoic Acid
3-Chloro-4-(methylsulfonyl)benzoic Acid (CAS# 1197193-45-5) is a undamental chemical building block commonly used in organic synthesis of more complex structures. A benzoic acid analogue that showed antifungal activity against strains of Aspergillus flavus, Aspergillus fumigatus and Aspergillus terreus, causative agents of human aspergillosis, in in vitro bioassays.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB004617 |
| Pricing | Inquire |
| Cas | 1197193-45-5 |
| Molecular Weight | 234.66 |
| Molecular Formula | C8H7ClO4S |
| Canonical SMILES | CS(=O)(=O)C1=C(C=C(C=C1)C(=O)O)Cl |