4-Aminophenyl b-D-cellobioside
The compound, 4-Aminophenyl b-D-cellobioside boasts an intricate mechanism of action, wherein it ingeniously targets and engages specific cellular receptors, deftly modulating pivotal cellular pathways. It demonstrates an exceptional potential for research of tackling afflictions ranging from cancer to diabetes and even neurodegenerative disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 42935-24-0 |
| Pricing | Inquire |
| Cas | 42935-24-0 |
| Molecular Weight | 433.41 |
| Molecular Formula | C18H27NO11 |
| Canonical SMILES | C1=CC(=CC=C1N)OC2C(C(C(C(O2)CO)OC3C(C(C(C(O3)CO)O)O)O)O)O |