Talotrexin ammonium
Talotrexin ammonium is the ammonium salt of an antimetabolite analogue of aminopterin with potential antineoplastic activity. As a folate antagonist, talotrexin binds to and inhibits the function of dihydrofolate reductase, resulting in the inhibition of folate metabolism, DNA synthesis, and cell division. Hydrosoluble, talotrexin is actively transported into cells by the reduced folate carrier (RFC) and, therefore, is unlikely to be associated with P-glycoprotein-mediated multidrug resistance.
| Supplier | BOC Sciences |
|---|---|
| Product # | 648420-92-2 |
| Pricing | Inquire |
| Cas | 648420-92-2 |
| Molecular Weight | 590.60 |
| Molecular Formula | C28H34N10O6 |
| Canonical SMILES | C1=CC=C(C(=C1)C(=O)NCCCC(C(=O)O)NC(=O)C2=CC=C(C=C2)NCC3=CN=C4C(=N3)C(=NC(=N4)N)N)C(=O)O.N |