HSV-1/HSV-2-IN-1
HSV-1/HSV-2-IN-1 (compound 7d) is a HSV-1 and HSV-2 inhibitor, with EC50s of 7.6, 7.6, 4, and 12 μM for HSV-1 (KOS), HSV-2(G), HSV-1 TK- KOS ACVr and vaccinia virus in human embryonic lung fibroblast cell cultures.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2490468-31-8 |
| Pricing | Inquire |
| Cas | 2490468-31-8 |
| Molecular Weight | 410.39 |
| Molecular Formula | C18H14F4N4OS |
| Canonical SMILES | CCN1C2=C(C=C(C=C2)F)C(=C1O)N=NC(=S)NC3=CC=C(C=C3)C(F)(F)F |