2H-1-Benzopyran-3-carboxylicacid, 2-oxo-, ethyl ester
2H-1-Benzopyran-3-carboxylic acid, 2-oxo-, ethyl ester is an essential natural compound widely used in the biomedical industry. This product is utilized in the development of drugs targeting various diseases, such as cancer, cardiovascular disorders and neurodegenerative conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1846-76-0 |
| Pricing | Inquire |
| Cas | 1846-76-0 |
| Molecular Weight | 218.2 |
| Molecular Formula | C12H10O4 |
| Canonical SMILES | CCOC(=O)C1=CC2=CC=CC=C2OC1=O |