8-Oxo-2'-deoxyguanosine
8-Oxo-2'-deoxyguanosine is a crucial biomarker to evaluate oxidative DNA damage in research of related diseases such as cancer and neurodegenerative disorders. It is an oxidized nucleoside known for its ability to accurately measure the level of oxidative stress.
| Supplier | BOC Sciences |
|---|---|
| Product # | 88847-89-6 |
| Pricing | Inquire |
| Cas | 88847-89-6 |
| Molecular Weight | 283.24 |
| Molecular Formula | C10H13N5O5 |
| Canonical SMILES | C1C(C(OC1N2C3=C(C(=O)NC(=N3)N)NC2=O)CO)O |