3',5',N2-Tri-O-acetyl 2'-Deoxyguanosine
3',5',N2-Tri-O-acetyl 2'-Deoxyguanosine, an indispensable constituent extensively utilized in the biomedical sector, emerges as a pivotal compound. It finds widespread application in the sphere of antiviral drug research, with a specific emphasis on combating prevalent viral afflictions like hepatitis B and C. By exemplifying formidable inhibitory properties against viral replication, this product plays a vital role in arresting the advancement of such ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 193092-29-4 |
| Pricing | Inquire |
| Cas | 193092-29-4 |
| Molecular Weight | 393.35 |
| Molecular Formula | C16H19N5O7 |
| Canonical SMILES | CC(=O)NC1=NC2=C(C(=O)N1)N=CN2C3CC(C(O3)COC(=O)C)OC(=O)C |