Sodium 3-Formylbenzenesulfonate
3-Sulfobenzaldehyde Sodium Salt, can be used for the preparation of a series of novel sulfonamide derivatives, as inhibitors of the enzyme histone deacetylase (HDAC) as a novel approach to the treatment of cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB028125 |
| Pricing | Inquire |
| Cas | 5330-48-3 |
| Molecular Weight | 208.17 |
| Molecular Formula | C7H5O4SNa |
| Canonical SMILES | C1=CC(=CC(=C1)S(=O)(=O)[O-])C=O.[Na+] |