Epothilon B
Epothilons B is a 16-membered macrolide antibiotic produced by the myxobacterium Sorangium cellulosum, which is used as a microtubule stabilization agent (EC0.01 = 1.8 μM). It has strong cytotoxicity and has the effect of resisting plant pathogenic fungi.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00852 |
| Pricing | Inquire |
| Cas | 152044-54-7 |
| Molecular Weight | 507.68 |
| Molecular Formula | C27H41NO6S |
| Canonical SMILES | CC1CCCC2(C(O2)CC(OC(=O)CC(C(C(=O)C(C1O)C)(C)C)O)C(=CC3=CSC(=N3)C)C)C |