Azinomycin B
Azinomycin B is produced by the strain of Streptomyces griseofuscus. It was highly cytotoxic, and the cytotoxicity of A and B to L5178Y cell IC50 was 0.07 g/mL and 0.11 g/mL, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00242 |
| Pricing | Inquire |
| Molecular Weight | 623.61 |
| Molecular Formula | C31H33N3O11 |
| Canonical SMILES | CC1=C2C=C(C=C(C2=CC=C1)C(=O)OC(C(=O)NC(=C3C(C(C4N3C4)O)OC(=O)C)C(=O)NC(=CO)C(=O)C)C5(CO5)C)OC |