Hexanoyl-L-carnitine-[N-methyl-d3] hydrochloride
Hexanoyl-L-carnitine-[N-methyl-d3] hydrochloride is an isotopically labelled analogue of Caproyl-L-carnitine HCl, which is intended for use as an internal standard for the quantification of hexanoyl-L-carnitine by GC- or LC-MS. Hexanoyl-L-carnitine Hydrochloride is used as a reactant in the synthesis of carnitine benzyl esters as prodrugs.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-005954 |
| Pricing | Inquire |
| Cas | 2483831-95-2 |
| Molecular Weight | 298.82 |
| Molecular Formula | C13H23D3ClNO4 |
| Canonical SMILES | CCCCCC(=O)CC(CC(=O)[O-])C[N+](C)(C)C.Cl |