Boc-Gly-Gly-Phe-OH
Boc-Gly-Gly-Phe-OH is a biochemical compound widely used in the biomedical industry. It acts as a potent inhibitor, targeting specific enzymes involved in the growth and proliferation of cancer cells. This product demonstrates promising potential in the treatment of various types of cancers by hindering their progression and metastasis.
Supplier | BOC Sciences |
---|---|
Product # | BADC-01442 |
Pricing | Inquire |
Cas | 39621-73-3 |
Molecular Weight | 379.41 |
Molecular Formula | C18H25N3O6 |
Canonical SMILES | CC(C)(C)OC(=O)NCC(=O)NCC(=O)NC(CC1=CC=CC=C1)C(=O)O |