3-(4-Chlorophenyl)glutaric Acid-[d4]
3-(4-Chlorophenyl)glutaric Acid-[d4] is the labelled analogue of 3-(4-Chlorophenyl)glutaric Acid (Baclofen Impurity 1), which is an impurity of Baclofen. Baclofen, an agonist of GABAB receptor, could be effective as a skeletal muscle relaxant and has been also found to have antispastic effect.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002644 |
| Pricing | Inquire |
| Cas | 1189874-68-7 |
| Molecular Weight | 246.68 |
| Molecular Formula | C11H7D4ClO4 |
| Canonical SMILES | C1=CC(=CC=C1C(CC(=O)O)CC(=O)O)Cl |