ATM Inhibitor-1
ATM Inhibitor-1 is a highly potent, selective and orally active ATM inhibitor (IC50 = 0.7 nM) with anti-tumor activity. It shows weak activity against mTOR (IC50 = 21 μM), DNAPK (IC50 = 2.8 μM), PI3K (IC50 = 3.8 μM), PI3K (IC50 = 10.3 μM), PI3K (IC50 = 3 μM) and PI3K (IC50 = 0.73 μM).
| Supplier | BOC Sciences |
|---|---|
| Product # | 2135639-94-8 |
| Pricing | Inquire |
| Cas | 2135639-94-8 |
| Molecular Weight | 492.61 |
| Molecular Formula | C27H36N6O3 |
| Canonical SMILES | CC(C1CCOCC1)NC2=C(N=NC3=C2C=C(C=C3)C4=CN=C(C=C4)OCCCN(C)C)C(=O)NC |