Brevicompanine B
A diketopiperazine-related metabolite produced by penicillium brevicompactum and aspergillus species. It has obvious plant growth regulation activity, but is devoid of antifungal or antimicrobial activity. It is active against Plasmodium falciparum.
| Supplier | BOC Sciences |
|---|---|
| Product # | 215121-47-4 |
| Pricing | Inquire |
| Cas | 215121-47-4 |
| Molecular Weight | 367.48 |
| Molecular Formula | C22H29N3O2 |
| Canonical SMILES | CC(C)CC1C(=O)N2C(CC3(C2NC4=CC=CC=C43)C(C)(C)C=C)C(=O)N1 |