6-Aminophenanthridine
6-Aminophenanthridine is an antiprion agent. It inhibits prion formation in yeast- and mammalian-based screening assays when used alone and, to a greater extent, when used in combination with the α2-adrenergic receptor agonist guanabenz.
| Supplier | BOC Sciences |
|---|---|
| Product # | 832-68-8 |
| Pricing | Inquire |
| Cas | 832-68-8 |
| Molecular Weight | 194.23 |
| Molecular Formula | C13H10N2 |
| Canonical SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N=C2N |