2-(7-methoxynaphthalen-1-yl)ethan-1-amine
7-Methoxy-1-naphthaleneethanamine Hydrochloride acts as a reagent for the synthesis of antidepressant agomelatine by a tandem allylic chlorination-isomerization process. Also, acts as a reagent in the design, preparation and in vitro evaluation of melatonin derivatives as serotonin N-acetyltransferase inhibitors.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB008716 |
| Pricing | Inquire |
| Cas | 138113-09-4 |
| Molecular Weight | 201.269 |
| Molecular Formula | C13H15NO |
| Canonical SMILES | COC1=CC2=C(C=CC=C2CCN)C=C1 |