Apalutamide-[d3]
Apalutamide-[d3] is an isotope analogue of Apalutamide which is a potent and competitive androgen receptor (AR) antagonist with potential antineoplastic activity. It binds to AR in target tissues thereby preventing androgen-induced receptor activation and facilitating the formation of inactive complexes that cannot be translocated to the nucleus.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-003319 |
| Pricing | Inquire |
| Cas | 1638885-61-6 |
| Molecular Weight | 480.45 |
| Molecular Formula | C21H12D3F4N5O2S |
| Canonical SMILES | CNC(=O)C1=C(C=C(C=C1)N2C(=S)N(C(=O)C23CCC3)C4=CC(=C(N=C4)C#N)C(F)(F)F)F |