rel-(7S,7'S,8R,8'R)-Magnolin
rel-(7S,7'S,8R,8'R)-Magnolin is an extraordinarily robust natural compound, celebrated for its virtuous anticancer attributes. Its profound efficacy in repressing a multitude of cancer cell lines, ranging from breast and lung to colon, has been unequivocally established.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP4120 |
| Pricing | Inquire |
| Cas | 1275595-33-9 |
| Molecular Weight | 416.47 |
| Molecular Formula | C23H28O7 |
| Canonical SMILES | O(C1=CC=C(C=C1OC)C2OCC3C(OCC23)C4=CC(OC)=C(OC)C(OC)=C4)C |