VPC 12249 (S) (ammonium salt)
VPC 12249 (S) (ammonium salt) is an innovative compound with potent anti-cancer properties, showcasing potential as a therapeutic agent against a multitude of cancer types, such as breast and pancreatic carcinoma. Its mechanism of action involves precise modulation of key oncogenic signaling cascades, demonstrating efficacy in tumor suppression.
| Supplier | BOC Sciences |
|---|---|
| Product # | 799268-73-8 |
| Pricing | Inquire |
| Cas | 799268-73-8 |
| Molecular Weight | 618.78 |
| Molecular Formula | C34H55N2O6P |
| Canonical SMILES | CCCCCCCCC=CCCCCCCCC(=O)NC(CC1=CC=C(C=C1)OCC2=CC=CC=C2)COP(=O)(O)[O-].[NH4+] |