5,7-Dichloro-1,2,3,4-tetrahydroisoquinoline-6-carboxylic acid monohydrochloride
5,7-Dichloro-1,2,3,4-tetrahydroisoquinoline-6-carboxylic acid monohydrochloride, a multifaceted compound utilized in the biomedical realm, showcases promising attributes in combatting an array of ailments such as cancer and neurological dysfunctions through intricate molecular interactions and targeted therapeutic interventions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1289646-93-0 |
| Pricing | Inquire |
| Cas | 1289646-93-0 |
| Molecular Weight | 282.55 |
| Molecular Formula | C10H9Cl2NO2.HCl |
| Canonical SMILES | C1CNCC2=CC(=C(C(=C21)Cl)C(=O)O)Cl.Cl |