AZD5582 acetate
AZD5582 acetate is a potent IAP inhibitor that binds potently to the BIR3 domains of cIAP1, cIAP2, and XIAP (IC50 = 15, 21, and 15 nM, respectively). It causes cIAP1 degradation and induces apoptosis in the MDA-MB-231 breast cancer cell line at subnanomolar concentrations in vitro.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-016330 |
| Pricing | Inquire |
| Molecular Weight | 1075.36 |
| Molecular Formula | C60H82N8O10 |
| Canonical SMILES | CC(C(=O)NC(C1CCCCC1)C(=O)N2CCCC2C(=O)NC3C(CC4=CC=CC=C34)OCC#CC#CCOC5CC6=CC=CC=C6C5NC(=O)C7CCCN7C(=O)C(C8CCCCC8)NC(=O)C(C)NC)NC.CC(=O)O |