D-Glucose-6-phosphate barium salt (1:1)
D-Glucose-6-phosphate barium salt (1:1) is a remarkable biomedical compound renowned for its commendable potential in studying metabolic disorders like glycogen storage diseases and diabetes. It possesses an indispensable character as a fundamental precursor in sundry biochemical pathways, exerting a pivotal influence on the intricate realm of carbohydrate metabolism and energy generation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 5996-16-7 |
| Pricing | Inquire |
| Cas | 5996-16-7 |
| Molecular Weight | 395.45 |
| Molecular Formula | C6H11BaO9P |
| Canonical SMILES | C(C(C(C(C(C=O)O)O)O)O)OP(=O)([O-])[O-].[Ba+2] |