1-Z-Piperazine
1-Z-Piperazine (CAS# 31166-44-6) is used in the synthesis of serotonin 5-HT6 and dopamine D2 receptor ligands (1,2). It can also be used for the synthesis of a 11-C labelled ligands for imaging vesicular acetylcholine transporter.
| Supplier | BOC Sciences |
|---|---|
| Product # | 31166-44-6 |
| Pricing | Inquire |
| Cas | 31166-44-6 |
| Molecular Weight | 220.27 |
| Molecular Formula | C12H16N2O2 |
| Canonical SMILES | C1CN(CCN1)C(=O)OCC2=CC=CC=C2 |